C11H12Br2F2 — CID 105411138
1-[3-bromo-2-(bromomethyl)-2-methylpropyl]-3,5-difluorobenzene (PubChem CID 105411138) has the molecular formula C11H12Br2F2 and a molecular weight of 342.02 g/mol. Its IUPAC name is 1-[3-bromo-2-(bromomethyl)-2-methylpropyl]-3,5-difluorobenzene.
| Compound Name | 1-[3-bromo-2-(bromomethyl)-2-methylpropyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 105411138 |
| Molecular Formula | C11H12Br2F2 |
| Molecular Weight | 342.02 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | 1-[3-bromo-2-(bromomethyl)-2-methylpropyl]-3,5-difluorobenzene |
| SMILES | CC(CBr)(CBr)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H12Br2F2/c1-11(6-12,7-13)5-8-2-9(14)4-10(15)3-8/h2-4H,5-7H2,1H3 |
| InChIKey | WNOSVWALAZLFBC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.02 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|