C18H23NOS — CID 105411210
1-[4-methyl-3-(2-methylsulfanylphenoxy)phenyl]butan-2-amine (PubChem CID 105411210) has the molecular formula C18H23NOS and a molecular weight of 301.46 g/mol. Its IUPAC name is 1-[4-methyl-3-(2-methylsulfanylphenoxy)phenyl]butan-2-amine.
| Compound Name | 1-[4-methyl-3-(2-methylsulfanylphenoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 105411210 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[4-methyl-3-(2-methylsulfanylphenoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(C)c(Oc2ccccc2SC)c1 |
| InChI | InChI=1S/C18H23NOS/c1-4-15(19)11-14-10-9-13(2)17(12-14)20-16-7-5-6-8-18(16)21-3/h5-10,12,15H,4,11,19H2,1-3H3 |
| InChIKey | LKOKQEONEKJQFH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |