C17H19Br2NO — CID 105411268
1-[3-(2,4-dibromophenoxy)-4-methylphenyl]butan-2-amine (PubChem CID 105411268) has the molecular formula C17H19Br2NO and a molecular weight of 413.15 g/mol. Its IUPAC name is 1-[3-(2,4-dibromophenoxy)-4-methylphenyl]butan-2-amine.
| Compound Name | 1-[3-(2,4-dibromophenoxy)-4-methylphenyl]butan-2-amine |
|---|---|
| PubChem CID | 105411268 |
| Molecular Formula | C17H19Br2NO |
| Molecular Weight | 413.15 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 1-[3-(2,4-dibromophenoxy)-4-methylphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(C)c(Oc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C17H19Br2NO/c1-3-14(20)8-12-5-4-11(2)17(9-12)21-16-7-6-13(18)10-15(16)19/h4-7,9-10,14H,3,8,20H2,1-2H3 |
| InChIKey | QMSKKNLJDSBONV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.15 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |