C18H27F2N — CID 105411507
N-[[2-[(3,5-difluorophenyl)methyl]cycloheptyl]methyl]propan-1-amine (PubChem CID 105411507) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is N-[[2-[(3,5-difluorophenyl)methyl]cycloheptyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(3,5-difluorophenyl)methyl]cycloheptyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 105411507 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-[[2-[(3,5-difluorophenyl)methyl]cycloheptyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCCC1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H27F2N/c1-2-8-21-13-16-7-5-3-4-6-15(16)9-14-10-17(19)12-18(20)11-14/h10-12,15-16,21H,2-9,13H2,1H3 |
| InChIKey | YESQENFUDVHYEA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|