C11H11F2NO — CID 105411995
1-(azetidin-3-yl)-2-(3,5-difluorophenyl)ethanone (PubChem CID 105411995) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-2-(3,5-difluorophenyl)ethanone.
| Compound Name | 1-(azetidin-3-yl)-2-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 105411995 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(azetidin-3-yl)-2-(3,5-difluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)cc(F)c1)C1CNC1 |
| InChI | InChI=1S/C11H11F2NO/c12-9-1-7(2-10(13)4-9)3-11(15)8-5-14-6-8/h1-2,4,8,14H,3,5-6H2 |
| InChIKey | GMRCKJQGELNDSN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |