C16H14F2O3 — CID 105412160
2-(3,5-difluorophenyl)-1-(2,3-dimethoxyphenyl)ethanone (PubChem CID 105412160) has the molecular formula C16H14F2O3 and a molecular weight of 292.28 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-(2,3-dimethoxyphenyl)ethanone.
| Compound Name | 2-(3,5-difluorophenyl)-1-(2,3-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 105412160 |
| Molecular Formula | C16H14F2O3 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-(2,3-dimethoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)Cc2cc(F)cc(F)c2)c1OC |
| InChI | InChI=1S/C16H14F2O3/c1-20-15-5-3-4-13(16(15)21-2)14(19)8-10-6-11(17)9-12(18)7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | DYPFACALCRILIF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |