C18H35N3O2 — CID 105415924
tert-butyl N-[[2-[[1-(dimethylamino)cyclobutyl]methylamino]cyclopentyl]methyl]carbamate (PubChem CID 105415924) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is tert-butyl N-[[2-[[1-(dimethylamino)cyclobutyl]methylamino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[[1-(dimethylamino)cyclobutyl]methylamino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 105415924 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | tert-butyl N-[[2-[[1-(dimethylamino)cyclobutyl]methylamino]cyclopentyl]methyl]carbamate |
| SMILES | CN(C)C1(CNC2CCCC2CNC(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C18H35N3O2/c1-17(2,3)23-16(22)19-12-14-8-6-9-15(14)20-13-18(21(4)5)10-7-11-18/h14-15,20H,6-13H2,1-5H3,(H,19,22) |
| InChIKey | BOUFLEZLAQOKIL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |