C10H19ClN2O — CID 105415955
3-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]propanamide (PubChem CID 105415955) has the molecular formula C10H19ClN2O and a molecular weight of 218.73 g/mol. Its IUPAC name is 3-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]propanamide.
| Compound Name | 3-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]propanamide |
|---|---|
| PubChem CID | 105415955 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-chloro-N-[[1-(dimethylamino)cyclobutyl]methyl]propanamide |
| SMILES | CN(C)C1(CNC(=O)CCCl)CCC1 |
| InChI | InChI=1S/C10H19ClN2O/c1-13(2)10(5-3-6-10)8-12-9(14)4-7-11/h3-8H2,1-2H3,(H,12,14) |
| InChIKey | ITSUJOJAVNYHKS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|