C14H29N3O5S — CID 154913579
N-[[1-(dimethylamino)cyclohexyl]methyl]-4-sulfamoylbutanamide;formic acid (PubChem CID 154913579) has the molecular formula C14H29N3O5S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclohexyl]methyl]-4-sulfamoylbutanamide;formic acid.
| Compound Name | N-[[1-(dimethylamino)cyclohexyl]methyl]-4-sulfamoylbutanamide;formic acid |
|---|---|
| PubChem CID | 154913579 |
| Molecular Formula | C14H29N3O5S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-[[1-(dimethylamino)cyclohexyl]methyl]-4-sulfamoylbutanamide;formic acid |
| SMILES | CN(C)C1(CNC(=O)CCCS(N)(=O)=O)CCCCC1.O=CO |
| InChI | InChI=1S/C13H27N3O3S.CH2O2/c1-16(2)13(8-4-3-5-9-13)11-15-12(17)7-6-10-20(14,18)19;2-1-3/h3-11H2,1-2H3,(H,15,17)(H2,14,18,19);1H,(H,2,3) |
| InChIKey | CXDRGRQFFHETPM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|