C11H23BrN2 — CID 105416269
1-[[3-bromopropyl(methyl)amino]methyl]-N,N-dimethylcyclobutan-1-amine (PubChem CID 105416269) has the molecular formula C11H23BrN2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 1-[[3-bromopropyl(methyl)amino]methyl]-N,N-dimethylcyclobutan-1-amine.
| Compound Name | 1-[[3-bromopropyl(methyl)amino]methyl]-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 105416269 |
| Molecular Formula | C11H23BrN2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-[[3-bromopropyl(methyl)amino]methyl]-N,N-dimethylcyclobutan-1-amine |
| SMILES | CN(CCCBr)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C11H23BrN2/c1-13(2)11(6-4-7-11)10-14(3)9-5-8-12/h4-10H2,1-3H3 |
| InChIKey | GESBGLXPTYIHRU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|