C10H20N2O2 — CID 105416372
3-[[1-(dimethylamino)cyclobutyl]methylamino]propanoic acid (PubChem CID 105416372) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-[[1-(dimethylamino)cyclobutyl]methylamino]propanoic acid.
| Compound Name | 3-[[1-(dimethylamino)cyclobutyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 105416372 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3-[[1-(dimethylamino)cyclobutyl]methylamino]propanoic acid |
| SMILES | CN(C)C1(CNCCC(=O)O)CCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-12(2)10(5-3-6-10)8-11-7-4-9(13)14/h11H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | FGFGDHILADEKMK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|