C11H20N2O2 — CID 103268943
(E)-4-[[1-(dimethylamino)cyclobutyl]methylamino]but-2-enoic acid (PubChem CID 103268943) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (E)-4-[[1-(dimethylamino)cyclobutyl]methylamino]but-2-enoic acid.
| Compound Name | (E)-4-[[1-(dimethylamino)cyclobutyl]methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103268943 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (E)-4-[[1-(dimethylamino)cyclobutyl]methylamino]but-2-enoic acid |
| SMILES | CN(C)C1(CNC/C=C/C(=O)O)CCC1 |
| InChI | InChI=1S/C11H20N2O2/c1-13(2)11(6-4-7-11)9-12-8-3-5-10(14)15/h3,5,12H,4,6-9H2,1-2H3,(H,14,15)/b5-3+ |
| InChIKey | FSLJYUGSFZDNQK-HWKANZROSA-N |
| XLogP | 0.70 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|