C13H21N3O4 — CID 83121179
(E)-4-[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 83121179) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is (E)-4-[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 83121179 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (E)-4-[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CN(C)C1(CNC(=O)NC(=O)/C=C/C(=O)O)CCCC1 |
| InChI | InChI=1S/C13H21N3O4/c1-16(2)13(7-3-4-8-13)9-14-12(20)15-10(17)5-6-11(18)19/h5-6H,3-4,7-9H2,1-2H3,(H,18,19)(H2,14,15,17,20)/b6-5+ |
| InChIKey | FDKYZEAKARMDFM-AATRIKPKSA-N |
| XLogP | 0.33 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|