C12H24N2 — CID 105416854
N,N-dimethyl-1-[(2-methylidenebutylamino)methyl]cyclobutan-1-amine (PubChem CID 105416854) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2-methylidenebutylamino)methyl]cyclobutan-1-amine.
| Compound Name | N,N-dimethyl-1-[(2-methylidenebutylamino)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 105416854 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,N-dimethyl-1-[(2-methylidenebutylamino)methyl]cyclobutan-1-amine |
| SMILES | C=C(CC)CNCC1(N(C)C)CCC1 |
| InChI | InChI=1S/C12H24N2/c1-5-11(2)9-13-10-12(14(3)4)7-6-8-12/h13H,2,5-10H2,1,3-4H3 |
| InChIKey | NFQKAOQESLPKKV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|