C13H12N2O2S2 — CID 10541695
(2S,5S)-1-methyl-3-nitro-2,5-dithiophen-2-yl-2,5-dihydropyrrole (PubChem CID 10541695) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is (2S,5S)-1-methyl-3-nitro-2,5-dithiophen-2-yl-2,5-dihydropyrrole.
| Compound Name | (2S,5S)-1-methyl-3-nitro-2,5-dithiophen-2-yl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 10541695 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (2S,5S)-1-methyl-3-nitro-2,5-dithiophen-2-yl-2,5-dihydropyrrole |
| SMILES | CN1[C@H](c2cccs2)C=C([N+](=O)[O-])[C@H]1c1cccs1 |
| InChI | InChI=1S/C13H12N2O2S2/c1-14-9(11-4-2-6-18-11)8-10(15(16)17)13(14)12-5-3-7-19-12/h2-9,13H,1H3/t9-,13-/m0/s1 |
| InChIKey | PFWZGTSVKXEYMY-ZANVPECISA-N |
| XLogP | 3.70 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|