C12H14N2O2S — CID 7472920
(4aR,8aR)-4-oxido-3-thiophen-2-yl-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide (PubChem CID 7472920) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is (4aR,8aR)-4-oxido-3-thiophen-2-yl-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide.
| Compound Name | (4aR,8aR)-4-oxido-3-thiophen-2-yl-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide |
|---|---|
| PubChem CID | 7472920 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (4aR,8aR)-4-oxido-3-thiophen-2-yl-4a,5,6,7,8,8a-hexahydroquinoxalin-1-ium 1-oxide |
| SMILES | O=[N+]1C=C(c2cccs2)N([O-])[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C12H14N2O2S/c15-13-8-11(12-6-3-7-17-12)14(16)10-5-2-1-4-9(10)13/h3,6-10H,1-2,4-5H2/t9-,10-/m1/s1 |
| InChIKey | ZGCDLMGPGBBQBZ-NXEZZACHSA-N |
| XLogP | 2.95 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|