C15H33N3O2S — CID 105421445
N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methyl-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 105421445) has the molecular formula C15H33N3O2S and a molecular weight of 319.52 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methyl-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methyl-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 105421445 |
| Molecular Formula | C15H33N3O2S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-N-methyl-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | CC(C)NCCCCS(=O)(=O)N(C)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C15H33N3O2S/c1-14(2)16-11-6-7-12-21(19,20)18(5)13-15(17(3)4)9-8-10-15/h14,16H,6-13H2,1-5H3 |
| InChIKey | SRAVQKYUVQEVLS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|