C15H33N3O2S — CID 106088421
N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 106088421) has the molecular formula C15H33N3O2S and a molecular weight of 319.52 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106088421 |
| Molecular Formula | C15H33N3O2S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | CC(C)NCCCCS(=O)(=O)NCC1(C)CCN(C)CC1 |
| InChI | InChI=1S/C15H33N3O2S/c1-14(2)16-9-5-6-12-21(19,20)17-13-15(3)7-10-18(4)11-8-15/h14,16-17H,5-13H2,1-4H3 |
| InChIKey | CTBNPUZYPBULPJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|