C14H30N2O2S2 — CID 106090506
N-[(1-methylsulfanylcyclopentyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide (PubChem CID 106090506) has the molecular formula C14H30N2O2S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclopentyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide.
| Compound Name | N-[(1-methylsulfanylcyclopentyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106090506 |
| Molecular Formula | C14H30N2O2S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[(1-methylsulfanylcyclopentyl)methyl]-4-(propan-2-ylamino)butane-1-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)CCCCNC(C)C)CCCC1 |
| InChI | InChI=1S/C14H30N2O2S2/c1-13(2)15-10-6-7-11-20(17,18)16-12-14(19-3)8-4-5-9-14/h13,15-16H,4-12H2,1-3H3 |
| InChIKey | AAONFZQPLMKSQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|