C15H32N2O2S2 — CID 106092414
N-[(1-methylsulfanylcyclohexyl)methyl]-4-(propylamino)butane-1-sulfonamide (PubChem CID 106092414) has the molecular formula C15H32N2O2S2 and a molecular weight of 336.57 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclohexyl)methyl]-4-(propylamino)butane-1-sulfonamide.
| Compound Name | N-[(1-methylsulfanylcyclohexyl)methyl]-4-(propylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106092414 |
| Molecular Formula | C15H32N2O2S2 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | N-[(1-methylsulfanylcyclohexyl)methyl]-4-(propylamino)butane-1-sulfonamide |
| SMILES | CCCNCCCCS(=O)(=O)NCC1(SC)CCCCC1 |
| InChI | InChI=1S/C15H32N2O2S2/c1-3-11-16-12-7-8-13-21(18,19)17-14-15(20-2)9-5-4-6-10-15/h16-17H,3-14H2,1-2H3 |
| InChIKey | ZIKQDNKAIOGJCH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|