C13H28N2O2S2 — CID 106090686
N-[(1-methylsulfanylcyclobutyl)methyl]-4-(propylamino)butane-1-sulfonamide (PubChem CID 106090686) has the molecular formula C13H28N2O2S2 and a molecular weight of 308.51 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclobutyl)methyl]-4-(propylamino)butane-1-sulfonamide.
| Compound Name | N-[(1-methylsulfanylcyclobutyl)methyl]-4-(propylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106090686 |
| Molecular Formula | C13H28N2O2S2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[(1-methylsulfanylcyclobutyl)methyl]-4-(propylamino)butane-1-sulfonamide |
| SMILES | CCCNCCCCS(=O)(=O)NCC1(SC)CCC1 |
| InChI | InChI=1S/C13H28N2O2S2/c1-3-9-14-10-4-5-11-19(16,17)15-12-13(18-2)7-6-8-13/h14-15H,3-12H2,1-2H3 |
| InChIKey | IERMCAPFPJDWIL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|