C12H25NO3S2 — CID 106001860
4-hydroxy-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide (PubChem CID 106001860) has the molecular formula C12H25NO3S2 and a molecular weight of 295.47 g/mol. Its IUPAC name is 4-hydroxy-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide.
| Compound Name | 4-hydroxy-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 106001860 |
| Molecular Formula | C12H25NO3S2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-hydroxy-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)CCCCO)CCCCC1 |
| InChI | InChI=1S/C12H25NO3S2/c1-17-12(7-3-2-4-8-12)11-13-18(15,16)10-6-5-9-14/h13-14H,2-11H2,1H3 |
| InChIKey | HAQNPTFPMGYCRA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|