C11H21NO4S2 — CID 114115836
3-[(1-methylsulfanylcyclohexyl)methylsulfamoyl]propanoic acid (PubChem CID 114115836) has the molecular formula C11H21NO4S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 3-[(1-methylsulfanylcyclohexyl)methylsulfamoyl]propanoic acid.
| Compound Name | 3-[(1-methylsulfanylcyclohexyl)methylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 114115836 |
| Molecular Formula | C11H21NO4S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-[(1-methylsulfanylcyclohexyl)methylsulfamoyl]propanoic acid |
| SMILES | CSC1(CNS(=O)(=O)CCC(=O)O)CCCCC1 |
| InChI | InChI=1S/C11H21NO4S2/c1-17-11(6-3-2-4-7-11)9-12-18(15,16)8-5-10(13)14/h12H,2-9H2,1H3,(H,13,14) |
| InChIKey | SVQCFCAEEASRPS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |