C12H26N2O2S2 — CID 114142631
4-amino-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide (PubChem CID 114142631) has the molecular formula C12H26N2O2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is 4-amino-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide.
| Compound Name | 4-amino-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 114142631 |
| Molecular Formula | C12H26N2O2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-amino-N-[(1-methylsulfanylcyclohexyl)methyl]butane-1-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)CCCCN)CCCCC1 |
| InChI | InChI=1S/C12H26N2O2S2/c1-17-12(7-3-2-4-8-12)11-14-18(15,16)10-6-5-9-13/h14H,2-11,13H2,1H3 |
| InChIKey | KYEXLPMVSGDREE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|