C10H22N2O3S2 — CID 112751639
2-(2-aminoethoxy)-N-[(1-methylsulfanylcyclobutyl)methyl]ethanesulfonamide (PubChem CID 112751639) has the molecular formula C10H22N2O3S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-[(1-methylsulfanylcyclobutyl)methyl]ethanesulfonamide.
| Compound Name | 2-(2-aminoethoxy)-N-[(1-methylsulfanylcyclobutyl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 112751639 |
| Molecular Formula | C10H22N2O3S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-(2-aminoethoxy)-N-[(1-methylsulfanylcyclobutyl)methyl]ethanesulfonamide |
| SMILES | CSC1(CNS(=O)(=O)CCOCCN)CCC1 |
| InChI | InChI=1S/C10H22N2O3S2/c1-16-10(3-2-4-10)9-12-17(13,14)8-7-15-6-5-11/h12H,2-9,11H2,1H3 |
| InChIKey | ARNQPLAXAWSJAA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|