C9H19NO3S2 — CID 106002291
4-hydroxy-N-[(1-methylsulfanylcyclopropyl)methyl]butane-1-sulfonamide (PubChem CID 106002291) has the molecular formula C9H19NO3S2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-hydroxy-N-[(1-methylsulfanylcyclopropyl)methyl]butane-1-sulfonamide.
| Compound Name | 4-hydroxy-N-[(1-methylsulfanylcyclopropyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 106002291 |
| Molecular Formula | C9H19NO3S2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 4-hydroxy-N-[(1-methylsulfanylcyclopropyl)methyl]butane-1-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)CCCCO)CC1 |
| InChI | InChI=1S/C9H19NO3S2/c1-14-9(4-5-9)8-10-15(12,13)7-3-2-6-11/h10-11H,2-8H2,1H3 |
| InChIKey | IPNHXXBPDLCUKV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|