C13H16ClN3 — CID 105423688
3-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methylpropan-1-amine (PubChem CID 105423688) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 105423688 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1[nH]ncc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3/c1-15-7-3-6-13-12(9-16-17-13)10-4-2-5-11(14)8-10/h2,4-5,8-9,15H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | NOANEFPXPSLBTQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|