3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid

C12H10ClNO3 — CID 105423723

IUPAC3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid
SMILESO=C(O)CCc1nocc1-c1ccccc1Cl
InChIInChI=1S/C12H10ClNO3/c13-10-4-2-1-3-8(10)9-7-17-14-11(9)5-6-12(15)16/h1-4,7H,5-6H2,(H,15,16)
InChIKeyWGBCWRUDYGEYHV-UHFFFAOYSA-N
MW251.67 g/mol
LogP3.01
Rot. Bonds4

About 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid

3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid (PubChem CID 105423723) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid.

Molecular Properties

Compound Name3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid
PubChem CID105423723
Molecular FormulaC12H10ClNO3
Molecular Weight251.67 g/mol
Exact Mass251.03
IUPAC Name3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid
SMILESO=C(O)CCc1nocc1-c1ccccc1Cl
InChIInChI=1S/C12H10ClNO3/c13-10-4-2-1-3-8(10)9-7-17-14-11(9)5-6-12(15)16/h1-4,7H,5-6H2,(H,15,16)
InChIKeyWGBCWRUDYGEYHV-UHFFFAOYSA-N
XLogP3.01
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.67
LogP ≤ 53.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
The IUPAC name of 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid (CID 105423723) is 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid.
What is the SMILES notation for 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
The canonical SMILES for 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid is O=C(O)CCc1nocc1-c1ccccc1Cl.
What is the InChIKey of 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
The InChIKey is WGBCWRUDYGEYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO3/c13-10-4-2-1-3-8(10)9-7-17-14-11(9)5-6-12(15)16/h1-4,7H,5-6H2,(H,15,16).
What are the key properties of 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid has a molecular weight of 251.67 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid is sourced from PubChem (CID 105423723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).