C11H11ClN2O — CID 82287035
2-[3-(2-chlorophenyl)-1,2-oxazol-4-yl]ethanamine (PubChem CID 82287035) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-1,2-oxazol-4-yl]ethanamine.
| Compound Name | 2-[3-(2-chlorophenyl)-1,2-oxazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 82287035 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-1,2-oxazol-4-yl]ethanamine |
| SMILES | NCCc1conc1-c1ccccc1Cl |
| InChI | InChI=1S/C11H11ClN2O/c12-10-4-2-1-3-9(10)11-8(5-6-13)7-15-14-11/h1-4,7H,5-6,13H2 |
| InChIKey | MPDGVBXFURFAFQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |