C10H11N3O — CID 82281197
2-(3-pyridin-3-yl-1,2-oxazol-4-yl)ethanamine (PubChem CID 82281197) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-(3-pyridin-3-yl-1,2-oxazol-4-yl)ethanamine.
| Compound Name | 2-(3-pyridin-3-yl-1,2-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 82281197 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-(3-pyridin-3-yl-1,2-oxazol-4-yl)ethanamine |
| SMILES | NCCc1conc1-c1cccnc1 |
| InChI | InChI=1S/C10H11N3O/c11-4-3-9-7-14-13-10(9)8-2-1-5-12-6-8/h1-2,5-7H,3-4,11H2 |
| InChIKey | PCJBTYCOLCENGY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |