C9H9N3O — CID 82125165
(2-pyridin-3-yl-1,3-oxazol-4-yl)methanamine (PubChem CID 82125165) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is (2-pyridin-3-yl-1,3-oxazol-4-yl)methanamine.
| Compound Name | (2-pyridin-3-yl-1,3-oxazol-4-yl)methanamine |
|---|---|
| PubChem CID | 82125165 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (2-pyridin-3-yl-1,3-oxazol-4-yl)methanamine |
| SMILES | NCc1coc(-c2cccnc2)n1 |
| InChI | InChI=1S/C9H9N3O/c10-4-8-6-13-9(12-8)7-2-1-3-11-5-7/h1-3,5-6H,4,10H2 |
| InChIKey | IADKIPPIIYLQQX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |