C10H8FNO — CID 141159129
4-(fluoromethyl)-3-phenyl-1,2-oxazole (PubChem CID 141159129) has the molecular formula C10H8FNO and a molecular weight of 177.18 g/mol. Its IUPAC name is 4-(fluoromethyl)-3-phenyl-1,2-oxazole.
| Compound Name | 4-(fluoromethyl)-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 141159129 |
| Molecular Formula | C10H8FNO |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 4-(fluoromethyl)-3-phenyl-1,2-oxazole |
| SMILES | FCc1conc1-c1ccccc1 |
| InChI | InChI=1S/C10H8FNO/c11-6-9-7-13-12-10(9)8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | SPZAFHFELDECMS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |