C9H7NOS — CID 150967466
3-phenyl-1,2-oxazole-4-thiol (PubChem CID 150967466) has the molecular formula C9H7NOS and a molecular weight of 177.23 g/mol. Its IUPAC name is 3-phenyl-1,2-oxazole-4-thiol.
| Compound Name | 3-phenyl-1,2-oxazole-4-thiol |
|---|---|
| PubChem CID | 150967466 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 3-phenyl-1,2-oxazole-4-thiol |
| SMILES | Sc1conc1-c1ccccc1 |
| InChI | InChI=1S/C9H7NOS/c12-8-6-11-10-9(8)7-4-2-1-3-5-7/h1-6,12H |
| InChIKey | LNJUOCHKNHEVBU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|