C18H16N2O3 — CID 58833396
N-(2-hydroxyethyl)-4-(3-phenyl-1,2-oxazol-4-yl)benzamide (PubChem CID 58833396) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-(3-phenyl-1,2-oxazol-4-yl)benzamide.
| Compound Name | N-(2-hydroxyethyl)-4-(3-phenyl-1,2-oxazol-4-yl)benzamide |
|---|---|
| PubChem CID | 58833396 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(2-hydroxyethyl)-4-(3-phenyl-1,2-oxazol-4-yl)benzamide |
| SMILES | O=C(NCCO)c1ccc(-c2conc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O3/c21-11-10-19-18(22)15-8-6-13(7-9-15)16-12-23-20-17(16)14-4-2-1-3-5-14/h1-9,12,21H,10-11H2,(H,19,22) |
| InChIKey | FWBKSNJBPBXLFW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |