C13H12N3O4- — CID 19768618
N-[2-[(4-phenyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate (PubChem CID 19768618) has the molecular formula C13H12N3O4- and a molecular weight of 274.26 g/mol. Its IUPAC name is N-[2-[(4-phenyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate.
| Compound Name | N-[2-[(4-phenyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 19768618 |
| Molecular Formula | C13H12N3O4- |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-[2-[(4-phenyl-1,2-oxazole-3-carbonyl)amino]ethyl]carbamate |
| SMILES | O=C([O-])NCCNC(=O)c1nocc1-c1ccccc1 |
| InChI | InChI=1S/C13H13N3O4/c17-12(14-6-7-15-13(18)19)11-10(8-20-16-11)9-4-2-1-3-5-9/h1-5,8,15H,6-7H2,(H,14,17)(H,18,19)/p-1 |
| InChIKey | HKUOTHYRCDQWNN-UHFFFAOYSA-M |
| XLogP | 0.00 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|