C13H12FN3O4 — CID 19768597
2-[[4-(3-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]ethylcarbamic acid (PubChem CID 19768597) has the molecular formula C13H12FN3O4 and a molecular weight of 293.25 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[4-(3-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 19768597 |
| Molecular Formula | C13H12FN3O4 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNC(=O)c1nocc1-c1cccc(F)c1 |
| InChI | InChI=1S/C13H12FN3O4/c14-9-3-1-2-8(6-9)10-7-21-17-11(10)12(18)15-4-5-16-13(19)20/h1-3,6-7,16H,4-5H2,(H,15,18)(H,19,20) |
| InChIKey | VTQPUHILTWPJIS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|