C20H22N2O2S — CID 142891124
ethane;N-[4-(3-phenyl-1,2-oxazol-4-yl)phenyl]sulfanylpropanamide (PubChem CID 142891124) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is ethane;N-[4-(3-phenyl-1,2-oxazol-4-yl)phenyl]sulfanylpropanamide.
| Compound Name | ethane;N-[4-(3-phenyl-1,2-oxazol-4-yl)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 142891124 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | ethane;N-[4-(3-phenyl-1,2-oxazol-4-yl)phenyl]sulfanylpropanamide |
| SMILES | CC.CCC(=O)NSc1ccc(-c2conc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O2S.C2H6/c1-2-17(21)20-23-15-10-8-13(9-11-15)16-12-22-19-18(16)14-6-4-3-5-7-14;1-2/h3-12H,2H2,1H3,(H,20,21);1-2H3 |
| InChIKey | LJIINSMLEDATSD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|