C21H25NO4 — CID 159315015
benzaldehyde;ethane;3-phenyl-1,2-oxazole-4-carboxylic acid (PubChem CID 159315015) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is benzaldehyde;ethane;3-phenyl-1,2-oxazole-4-carboxylic acid.
| Compound Name | benzaldehyde;ethane;3-phenyl-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 159315015 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | benzaldehyde;ethane;3-phenyl-1,2-oxazole-4-carboxylic acid |
| SMILES | CC.CC.O=C(O)c1conc1-c1ccccc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C10H7NO3.C7H6O.2C2H6/c12-10(13)8-6-14-11-9(8)7-4-2-1-3-5-7;8-6-7-4-2-1-3-5-7;2*1-2/h1-6H,(H,12,13);1-6H;2*1-2H3 |
| InChIKey | LDAIUSXGHWXRJO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|