C18H16N2O2 — CID 100771775
N-(4-ethylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 100771775) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-ethylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 100771775 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-(4-ethylphenyl)-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2conc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O2/c1-2-13-8-10-15(11-9-13)19-18(21)16-12-22-20-17(16)14-6-4-3-5-7-14/h3-12H,2H2,1H3,(H,19,21) |
| InChIKey | YSIHGFFZTDVHSB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |