3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

C13H12N2O4 — CID 107369156

IUPAC3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESCCc1ccc(NC(=O)c2cc(C(=O)O)on2)cc1
InChIInChI=1S/C13H12N2O4/c1-2-8-3-5-9(6-4-8)14-12(16)10-7-11(13(17)18)19-15-10/h3-7H,2H2,1H3,(H,14,16)(H,17,18)
InChIKeyBBMJCOTWEQJYNJ-UHFFFAOYSA-N
MW260.25 g/mol
LogP2.19
Rot. Bonds4

About 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 107369156) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
PubChem CID107369156
Molecular FormulaC13H12N2O4
Molecular Weight260.25 g/mol
Exact Mass260.08
IUPAC Name3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESCCc1ccc(NC(=O)c2cc(C(=O)O)on2)cc1
InChIInChI=1S/C13H12N2O4/c1-2-8-3-5-9(6-4-8)14-12(16)10-7-11(13(17)18)19-15-10/h3-7H,2H2,1H3,(H,14,16)(H,17,18)
InChIKeyBBMJCOTWEQJYNJ-UHFFFAOYSA-N
XLogP2.19
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.25
LogP ≤ 52.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (CID 107369156) is 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is CCc1ccc(NC(=O)c2cc(C(=O)O)on2)cc1.
What is the InChIKey of 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is BBMJCOTWEQJYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4/c1-2-8-3-5-9(6-4-8)14-12(16)10-7-11(13(17)18)19-15-10/h3-7H,2H2,1H3,(H,14,16)(H,17,18).
What are the key properties of 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 260.25 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethylphenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 107369156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).