C15H18N2O2 — CID 105423795
2-methyl-3-[1-methyl-4-(3-methylphenyl)pyrazol-3-yl]propanoic acid (PubChem CID 105423795) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-methyl-3-[1-methyl-4-(3-methylphenyl)pyrazol-3-yl]propanoic acid.
| Compound Name | 2-methyl-3-[1-methyl-4-(3-methylphenyl)pyrazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 105423795 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-methyl-3-[1-methyl-4-(3-methylphenyl)pyrazol-3-yl]propanoic acid |
| SMILES | Cc1cccc(-c2cn(C)nc2CC(C)C(=O)O)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-10-5-4-6-12(7-10)13-9-17(3)16-14(13)8-11(2)15(18)19/h4-7,9,11H,8H2,1-3H3,(H,18,19) |
| InChIKey | CRCWARAOGOMRSQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |