C15H18N2O3 — CID 105423921
3-[4-(3-methoxyphenyl)-1-methylpyrazol-3-yl]-2-methylpropanoic acid (PubChem CID 105423921) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[4-(3-methoxyphenyl)-1-methylpyrazol-3-yl]-2-methylpropanoic acid.
| Compound Name | 3-[4-(3-methoxyphenyl)-1-methylpyrazol-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 105423921 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-[4-(3-methoxyphenyl)-1-methylpyrazol-3-yl]-2-methylpropanoic acid |
| SMILES | COc1cccc(-c2cn(C)nc2CC(C)C(=O)O)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-10(15(18)19)7-14-13(9-17(2)16-14)11-5-4-6-12(8-11)20-3/h4-6,8-10H,7H2,1-3H3,(H,18,19) |
| InChIKey | ILDYNRLVSVUTLO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |