C13H18ClNS — CID 105424365
[1-(3-chloro-4-propan-2-ylsulfanylphenyl)cyclopropyl]methanamine (PubChem CID 105424365) has the molecular formula C13H18ClNS and a molecular weight of 255.81 g/mol. Its IUPAC name is [1-(3-chloro-4-propan-2-ylsulfanylphenyl)cyclopropyl]methanamine.
| Compound Name | [1-(3-chloro-4-propan-2-ylsulfanylphenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 105424365 |
| Molecular Formula | C13H18ClNS |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | [1-(3-chloro-4-propan-2-ylsulfanylphenyl)cyclopropyl]methanamine |
| SMILES | CC(C)Sc1ccc(C2(CN)CC2)cc1Cl |
| InChI | InChI=1S/C13H18ClNS/c1-9(2)16-12-4-3-10(7-11(12)14)13(8-15)5-6-13/h3-4,7,9H,5-6,8,15H2,1-2H3 |
| InChIKey | RAMUJYRWGAVVNL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |