C13H16ClNS — CID 117388041
[1-(3-chloro-4-cyclopropylsulfanylphenyl)cyclopropyl]methanamine (PubChem CID 117388041) has the molecular formula C13H16ClNS and a molecular weight of 253.80 g/mol. Its IUPAC name is [1-(3-chloro-4-cyclopropylsulfanylphenyl)cyclopropyl]methanamine.
| Compound Name | [1-(3-chloro-4-cyclopropylsulfanylphenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 117388041 |
| Molecular Formula | C13H16ClNS |
| Molecular Weight | 253.80 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | [1-(3-chloro-4-cyclopropylsulfanylphenyl)cyclopropyl]methanamine |
| SMILES | NCC1(c2ccc(SC3CC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16ClNS/c14-11-7-9(13(8-15)5-6-13)1-4-12(11)16-10-2-3-10/h1,4,7,10H,2-3,5-6,8,15H2 |
| InChIKey | JFRHRJBXEKOOPE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |