C15H16ClNOS — CID 117474103
2-chloro-1-cyclopropylsulfanyl-4-(1-isocyanatocyclopentyl)benzene (PubChem CID 117474103) has the molecular formula C15H16ClNOS and a molecular weight of 293.82 g/mol. Its IUPAC name is 2-chloro-1-cyclopropylsulfanyl-4-(1-isocyanatocyclopentyl)benzene.
| Compound Name | 2-chloro-1-cyclopropylsulfanyl-4-(1-isocyanatocyclopentyl)benzene |
|---|---|
| PubChem CID | 117474103 |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-chloro-1-cyclopropylsulfanyl-4-(1-isocyanatocyclopentyl)benzene |
| SMILES | O=C=NC1(c2ccc(SC3CC3)c(Cl)c2)CCCC1 |
| InChI | InChI=1S/C15H16ClNOS/c16-13-9-11(3-6-14(13)19-12-4-5-12)15(17-10-18)7-1-2-8-15/h3,6,9,12H,1-2,4-5,7-8H2 |
| InChIKey | VLSOZIXGZHFJKP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|