C13H17ClO3S — CID 105424453
[1-(3-chloro-4-propan-2-ylsulfonylphenyl)cyclopropyl]methanol (PubChem CID 105424453) has the molecular formula C13H17ClO3S and a molecular weight of 288.80 g/mol. Its IUPAC name is [1-(3-chloro-4-propan-2-ylsulfonylphenyl)cyclopropyl]methanol.
| Compound Name | [1-(3-chloro-4-propan-2-ylsulfonylphenyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 105424453 |
| Molecular Formula | C13H17ClO3S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [1-(3-chloro-4-propan-2-ylsulfonylphenyl)cyclopropyl]methanol |
| SMILES | CC(C)S(=O)(=O)c1ccc(C2(CO)CC2)cc1Cl |
| InChI | InChI=1S/C13H17ClO3S/c1-9(2)18(16,17)12-4-3-10(7-11(12)14)13(8-15)5-6-13/h3-4,7,9,15H,5-6,8H2,1-2H3 |
| InChIKey | JYAMYLRISQHLGA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |