C11H14ClF2NO2S — CID 105424721
2-(3-chloro-4-propan-2-ylsulfonylphenyl)-2,2-difluoroethanamine (PubChem CID 105424721) has the molecular formula C11H14ClF2NO2S and a molecular weight of 297.75 g/mol. Its IUPAC name is 2-(3-chloro-4-propan-2-ylsulfonylphenyl)-2,2-difluoroethanamine.
| Compound Name | 2-(3-chloro-4-propan-2-ylsulfonylphenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 105424721 |
| Molecular Formula | C11H14ClF2NO2S |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(3-chloro-4-propan-2-ylsulfonylphenyl)-2,2-difluoroethanamine |
| SMILES | CC(C)S(=O)(=O)c1ccc(C(F)(F)CN)cc1Cl |
| InChI | InChI=1S/C11H14ClF2NO2S/c1-7(2)18(16,17)10-4-3-8(5-9(10)12)11(13,14)6-15/h3-5,7H,6,15H2,1-2H3 |
| InChIKey | YPFPALKMECPHNU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |