C10H17F2NO2S — CID 105426914
4-(3,3-difluoropiperidin-4-yl)thiane 1,1-dioxide (PubChem CID 105426914) has the molecular formula C10H17F2NO2S and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-(3,3-difluoropiperidin-4-yl)thiane 1,1-dioxide.
| Compound Name | 4-(3,3-difluoropiperidin-4-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 105426914 |
| Molecular Formula | C10H17F2NO2S |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(3,3-difluoropiperidin-4-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C2CCNCC2(F)F)CC1 |
| InChI | InChI=1S/C10H17F2NO2S/c11-10(12)7-13-4-1-9(10)8-2-5-16(14,15)6-3-8/h8-9,13H,1-7H2 |
| InChIKey | BOGWXEVQOVDLDC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |