C16H18O4S — CID 10542705
(4E)-4-(benzenesulfonylmethylidene)-5,5-dimethyl-3-propan-2-ylideneoxolan-2-one (PubChem CID 10542705) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (4E)-4-(benzenesulfonylmethylidene)-5,5-dimethyl-3-propan-2-ylideneoxolan-2-one.
| Compound Name | (4E)-4-(benzenesulfonylmethylidene)-5,5-dimethyl-3-propan-2-ylideneoxolan-2-one |
|---|---|
| PubChem CID | 10542705 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (4E)-4-(benzenesulfonylmethylidene)-5,5-dimethyl-3-propan-2-ylideneoxolan-2-one |
| SMILES | CC(C)=C1C(=O)OC(C)(C)/C1=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O4S/c1-11(2)14-13(16(3,4)20-15(14)17)10-21(18,19)12-8-6-5-7-9-12/h5-10H,1-4H3/b13-10+ |
| InChIKey | AMCXSNRMTOEGTN-JLHYYAGUSA-N |
| XLogP | 3.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|