C20H20O3 — CID 10542827
ethyl 4-ethoxytricyclo[8.4.1.02,6]pentadeca-1(14),2,4,6,8,10,12-heptaene-3-carboxylate (PubChem CID 10542827) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl 4-ethoxytricyclo[8.4.1.02,6]pentadeca-1(14),2,4,6,8,10,12-heptaene-3-carboxylate.
| Compound Name | ethyl 4-ethoxytricyclo[8.4.1.02,6]pentadeca-1(14),2,4,6,8,10,12-heptaene-3-carboxylate |
|---|---|
| PubChem CID | 10542827 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 4-ethoxytricyclo[8.4.1.02,6]pentadeca-1(14),2,4,6,8,10,12-heptaene-3-carboxylate |
| SMILES | CCOC(=O)C1=C2C3=CC=CC=C(/C=C\C=C/2C=C1OCC)C3 |
| InChI | InChI=1S/C20H20O3/c1-3-22-17-13-16-11-7-9-14-8-5-6-10-15(12-14)18(16)19(17)20(21)23-4-2/h5-11,13H,3-4,12H2,1-2H3/b9-7-,11-7-,14-9-,16-11-,18-15+ |
| InChIKey | BSSVUGYDGQKXAA-AFWSHJFYSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |